C15H18ClN3O3S — CID 17225113
2-[(4-chlorophenyl)methylsulfonyl]-N-(3-imidazol-1-ylpropyl)acetamide (PubChem CID 17225113) has the molecular formula C15H18ClN3O3S and a molecular weight of 355.85 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfonyl]-N-(3-imidazol-1-ylpropyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfonyl]-N-(3-imidazol-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 17225113 |
| Molecular Formula | C15H18ClN3O3S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfonyl]-N-(3-imidazol-1-ylpropyl)acetamide |
| SMILES | O=C(CS(=O)(=O)Cc1ccc(Cl)cc1)NCCCn1ccnc1 |
| InChI | InChI=1S/C15H18ClN3O3S/c16-14-4-2-13(3-5-14)10-23(21,22)11-15(20)18-6-1-8-19-9-7-17-12-19/h2-5,7,9,12H,1,6,8,10-11H2,(H,18,20) |
| InChIKey | JWJHUOPGPXXNQY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|