C15H19ClN4O3S — CID 51162141
3-[(3-chlorophenyl)sulfonylamino]-N-(3-imidazol-1-ylpropyl)propanamide (PubChem CID 51162141) has the molecular formula C15H19ClN4O3S and a molecular weight of 370.86 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)sulfonylamino]-N-(3-imidazol-1-ylpropyl)propanamide.
| Compound Name | 3-[(3-chlorophenyl)sulfonylamino]-N-(3-imidazol-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 51162141 |
| Molecular Formula | C15H19ClN4O3S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 3-[(3-chlorophenyl)sulfonylamino]-N-(3-imidazol-1-ylpropyl)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1cccc(Cl)c1)NCCCn1ccnc1 |
| InChI | InChI=1S/C15H19ClN4O3S/c16-13-3-1-4-14(11-13)24(22,23)19-7-5-15(21)18-6-2-9-20-10-8-17-12-20/h1,3-4,8,10-12,19H,2,5-7,9H2,(H,18,21) |
| InChIKey | KANGGGJVQMZZSV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|