C12H12ClN3O — CID 47019718
4-chloro-N-(2-imidazol-1-ylethyl)benzamide (PubChem CID 47019718) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is 4-chloro-N-(2-imidazol-1-ylethyl)benzamide.
| Compound Name | 4-chloro-N-(2-imidazol-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 47019718 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 4-chloro-N-(2-imidazol-1-ylethyl)benzamide |
| SMILES | O=C(NCCn1ccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H12ClN3O/c13-11-3-1-10(2-4-11)12(17)15-6-8-16-7-5-14-9-16/h1-5,7,9H,6,8H2,(H,15,17) |
| InChIKey | PFVGCDFEXWLYIH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |