C13H14F2N4O — CID 63185767
3,5-difluoro-N-(2-imidazol-1-ylethyl)-4-(methylamino)benzamide (PubChem CID 63185767) has the molecular formula C13H14F2N4O and a molecular weight of 280.28 g/mol. Its IUPAC name is 3,5-difluoro-N-(2-imidazol-1-ylethyl)-4-(methylamino)benzamide.
| Compound Name | 3,5-difluoro-N-(2-imidazol-1-ylethyl)-4-(methylamino)benzamide |
|---|---|
| PubChem CID | 63185767 |
| Molecular Formula | C13H14F2N4O |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3,5-difluoro-N-(2-imidazol-1-ylethyl)-4-(methylamino)benzamide |
| SMILES | CNc1c(F)cc(C(=O)NCCn2ccnc2)cc1F |
| InChI | InChI=1S/C13H14F2N4O/c1-16-12-10(14)6-9(7-11(12)15)13(20)18-3-5-19-4-2-17-8-19/h2,4,6-8,16H,3,5H2,1H3,(H,18,20) |
| InChIKey | WFTZGJUMPHRFMN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |