C21H28ClN3O2 — CID 97266725
(3R)-3-(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)-4-pyrrol-1-ylbutanamide (PubChem CID 97266725) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)-4-pyrrol-1-ylbutanamide.
| Compound Name | (3R)-3-(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)-4-pyrrol-1-ylbutanamide |
|---|---|
| PubChem CID | 97266725 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)-4-pyrrol-1-ylbutanamide |
| SMILES | O=C(C[C@@H](Cn1cccc1)c1ccc(Cl)cc1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C21H28ClN3O2/c22-20-6-4-18(5-7-20)19(17-25-9-1-2-10-25)16-21(26)23-8-3-11-24-12-14-27-15-13-24/h1-2,4-7,9-10,19H,3,8,11-17H2,(H,23,26)/t19-/m0/s1 |
| InChIKey | KUODGZWKDUWGKW-IBGZPJMESA-N |
| XLogP | 3.15 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|