C20H23ClFN7O — CID 155451217
1-(3-chloroisoquinolin-6-yl)-3-[4-[3-(dimethylamino)propylamino]-5-fluoro-6-methylpyrimidin-2-yl]urea (PubChem CID 155451217) has the molecular formula C20H23ClFN7O and a molecular weight of 431.90 g/mol. Its IUPAC name is 1-(3-chloroisoquinolin-6-yl)-3-[4-[3-(dimethylamino)propylamino]-5-fluoro-6-methylpyrimidin-2-yl]urea.
| Compound Name | 1-(3-chloroisoquinolin-6-yl)-3-[4-[3-(dimethylamino)propylamino]-5-fluoro-6-methylpyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 155451217 |
| Molecular Formula | C20H23ClFN7O |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-(3-chloroisoquinolin-6-yl)-3-[4-[3-(dimethylamino)propylamino]-5-fluoro-6-methylpyrimidin-2-yl]urea |
| SMILES | Cc1nc(NC(=O)Nc2ccc3cnc(Cl)cc3c2)nc(NCCCN(C)C)c1F |
| InChI | InChI=1S/C20H23ClFN7O/c1-12-17(22)18(23-7-4-8-29(2)3)27-19(25-12)28-20(30)26-15-6-5-13-11-24-16(21)10-14(13)9-15/h5-6,9-11H,4,7-8H2,1-3H3,(H3,23,25,26,27,28,30) |
| InChIKey | RJPZIDVTAIERSN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|