C18H19ClF3N5O3 — CID 59421757
N-(2-chloroethyl)-1-(cyclopropylmethyl)-4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]imidazole-2-carboxamide (PubChem CID 59421757) has the molecular formula C18H19ClF3N5O3 and a molecular weight of 445.83 g/mol. Its IUPAC name is N-(2-chloroethyl)-1-(cyclopropylmethyl)-4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]imidazole-2-carboxamide.
| Compound Name | N-(2-chloroethyl)-1-(cyclopropylmethyl)-4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]imidazole-2-carboxamide |
|---|---|
| PubChem CID | 59421757 |
| Molecular Formula | C18H19ClF3N5O3 |
| Molecular Weight | 445.83 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-(2-chloroethyl)-1-(cyclopropylmethyl)-4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]imidazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)Nc1cn(CC2CC2)c(C(=O)NCCCl)n1 |
| InChI | InChI=1S/C18H19ClF3N5O3/c19-7-8-23-16(28)15-25-14(10-27(15)9-11-1-2-11)26-17(29)24-12-3-5-13(6-4-12)30-18(20,21)22/h3-6,10-11H,1-2,7-9H2,(H,23,28)(H2,24,26,29) |
| InChIKey | AKDSYTSFHMMCNQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.83 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|