C27H26F4N6O3S — CID 170558340
4-fluoro-1-methyl-6-[[2-[(2-propan-2-ylphenyl)sulfanylcarbamoyl]hydrazinyl]methyl]-N-[4-(trifluoromethoxy)phenyl]indazole-3-carboxamide (PubChem CID 170558340) has the molecular formula C27H26F4N6O3S and a molecular weight of 590.60 g/mol. Its IUPAC name is 4-fluoro-1-methyl-6-[[2-[(2-propan-2-ylphenyl)sulfanylcarbamoyl]hydrazinyl]methyl]-N-[4-(trifluoromethoxy)phenyl]indazole-3-carboxamide.
| Compound Name | 4-fluoro-1-methyl-6-[[2-[(2-propan-2-ylphenyl)sulfanylcarbamoyl]hydrazinyl]methyl]-N-[4-(trifluoromethoxy)phenyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 170558340 |
| Molecular Formula | C27H26F4N6O3S |
| Molecular Weight | 590.60 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | 4-fluoro-1-methyl-6-[[2-[(2-propan-2-ylphenyl)sulfanylcarbamoyl]hydrazinyl]methyl]-N-[4-(trifluoromethoxy)phenyl]indazole-3-carboxamide |
| SMILES | CC(C)c1ccccc1SNC(=O)NNCc1cc(F)c2c(C(=O)Nc3ccc(OC(F)(F)F)cc3)nn(C)c2c1 |
| InChI | InChI=1S/C27H26F4N6O3S/c1-15(2)19-6-4-5-7-22(19)41-36-26(39)34-32-14-16-12-20(28)23-21(13-16)37(3)35-24(23)25(38)33-17-8-10-18(11-9-17)40-27(29,30)31/h4-13,15,32H,14H2,1-3H3,(H,33,38)(H2,34,36,39) |
| InChIKey | QQUFPBQTFVVEHL-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 109.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.60 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|