C19H16F3N3O3 — CID 121089502
3-(3-methoxyphenyl)-1-methyl-N-[4-(trifluoromethoxy)phenyl]pyrazole-5-carboxamide (PubChem CID 121089502) has the molecular formula C19H16F3N3O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-1-methyl-N-[4-(trifluoromethoxy)phenyl]pyrazole-5-carboxamide.
| Compound Name | 3-(3-methoxyphenyl)-1-methyl-N-[4-(trifluoromethoxy)phenyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 121089502 |
| Molecular Formula | C19H16F3N3O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 3-(3-methoxyphenyl)-1-methyl-N-[4-(trifluoromethoxy)phenyl]pyrazole-5-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3ccc(OC(F)(F)F)cc3)n(C)n2)c1 |
| InChI | InChI=1S/C19H16F3N3O3/c1-25-17(11-16(24-25)12-4-3-5-15(10-12)27-2)18(26)23-13-6-8-14(9-7-13)28-19(20,21)22/h3-11H,1-2H3,(H,23,26) |
| InChIKey | YNGZOAZAIJKMIZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |