C17H11F3N6O3 — CID 135345807
1-methyl-3-[[4-(trifluoromethoxy)benzoyl]amino]indazole-6-carbonyl azide (PubChem CID 135345807) has the molecular formula C17H11F3N6O3 and a molecular weight of 404.31 g/mol. Its IUPAC name is 1-methyl-3-[[4-(trifluoromethoxy)benzoyl]amino]indazole-6-carbonyl azide.
| Compound Name | 1-methyl-3-[[4-(trifluoromethoxy)benzoyl]amino]indazole-6-carbonyl azide |
|---|---|
| PubChem CID | 135345807 |
| Molecular Formula | C17H11F3N6O3 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 1-methyl-3-[[4-(trifluoromethoxy)benzoyl]amino]indazole-6-carbonyl azide |
| SMILES | Cn1nc(NC(=O)c2ccc(OC(F)(F)F)cc2)c2ccc(C(=O)N=[N+]=[N-])cc21 |
| InChI | InChI=1S/C17H11F3N6O3/c1-26-13-8-10(16(28)23-25-21)4-7-12(13)14(24-26)22-15(27)9-2-5-11(6-3-9)29-17(18,19)20/h2-8H,1H3,(H,22,24,27) |
| InChIKey | QAPKPVXDGGCSTQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|