C27H26F3N7O2S — CID 172930218
1-[(E)-[1-methyl-3-[2-[4-(trifluoromethoxy)benzoyl]hydrazinyl]indazol-6-yl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea (PubChem CID 172930218) has the molecular formula C27H26F3N7O2S and a molecular weight of 569.61 g/mol. Its IUPAC name is 1-[(E)-[1-methyl-3-[2-[4-(trifluoromethoxy)benzoyl]hydrazinyl]indazol-6-yl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[(E)-[1-methyl-3-[2-[4-(trifluoromethoxy)benzoyl]hydrazinyl]indazol-6-yl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 172930218 |
| Molecular Formula | C27H26F3N7O2S |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 1-[(E)-[1-methyl-3-[2-[4-(trifluoromethoxy)benzoyl]hydrazinyl]indazol-6-yl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)c1ccccc1NC(=S)N/N=C/c1ccc2c(NNC(=O)c3ccc(OC(F)(F)F)cc3)nn(C)c2c1 |
| InChI | InChI=1S/C27H26F3N7O2S/c1-16(2)20-6-4-5-7-22(20)32-26(40)35-31-15-17-8-13-21-23(14-17)37(3)36-24(21)33-34-25(38)18-9-11-19(12-10-18)39-27(28,29)30/h4-16H,1-3H3,(H,33,36)(H,34,38)(H2,32,35,40)/b31-15+ |
| InChIKey | RFHJMECXHFBLDJ-IBBHUPRXSA-N |
| XLogP | 5.67 |
| TPSA | 104.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|