C28H26F3N7OS — CID 162752984
2-methyl-5-[4-[(E)-[(2-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]phenyl]-N-[4-(trifluoromethyl)phenyl]-1,2,4-triazole-3-carboxamide (PubChem CID 162752984) has the molecular formula C28H26F3N7OS and a molecular weight of 565.63 g/mol. Its IUPAC name is 2-methyl-5-[4-[(E)-[(2-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]phenyl]-N-[4-(trifluoromethyl)phenyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 2-methyl-5-[4-[(E)-[(2-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]phenyl]-N-[4-(trifluoromethyl)phenyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 162752984 |
| Molecular Formula | C28H26F3N7OS |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 2-methyl-5-[4-[(E)-[(2-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]phenyl]-N-[4-(trifluoromethyl)phenyl]-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)c1ccccc1NC(=S)N/N=C/c1ccc(-c2nc(C(=O)Nc3ccc(C(F)(F)F)cc3)n(C)n2)cc1 |
| InChI | InChI=1S/C28H26F3N7OS/c1-17(2)22-6-4-5-7-23(22)34-27(40)36-32-16-18-8-10-19(11-9-18)24-35-25(38(3)37-24)26(39)33-21-14-12-20(13-15-21)28(29,30)31/h4-17H,1-3H3,(H,33,39)(H2,34,36,40)/b32-16+ |
| InChIKey | IGMWAAMXYVUPRL-KPGMTVGESA-N |
| XLogP | 6.20 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|