C27H31F2N7OS — CID 175715285
N-(4,4-difluorocyclohexyl)-2-methyl-5-[4-[[(2-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]phenyl]-1,2,4-triazole-3-carboxamide (PubChem CID 175715285) has the molecular formula C27H31F2N7OS and a molecular weight of 539.66 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-2-methyl-5-[4-[[(2-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]phenyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-2-methyl-5-[4-[[(2-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]phenyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 175715285 |
| Molecular Formula | C27H31F2N7OS |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-2-methyl-5-[4-[[(2-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]phenyl]-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)c1ccccc1NC(=S)NN=Cc1ccc(-c2nc(C(=O)NC3CCC(F)(F)CC3)n(C)n2)cc1 |
| InChI | InChI=1S/C27H31F2N7OS/c1-17(2)21-6-4-5-7-22(21)32-26(38)34-30-16-18-8-10-19(11-9-18)23-33-24(36(3)35-23)25(37)31-20-12-14-27(28,29)15-13-20/h4-11,16-17,20H,12-15H2,1-3H3,(H,31,37)(H2,32,34,38) |
| InChIKey | ILPKLGPMHCJREW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|