C26H26N6OS — CID 89381975
1-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]-3-[(2-propan-2-ylphenyl)carbamothioyl]urea (PubChem CID 89381975) has the molecular formula C26H26N6OS and a molecular weight of 470.60 g/mol. Its IUPAC name is 1-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]-3-[(2-propan-2-ylphenyl)carbamothioyl]urea.
| Compound Name | 1-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]-3-[(2-propan-2-ylphenyl)carbamothioyl]urea |
|---|---|
| PubChem CID | 89381975 |
| Molecular Formula | C26H26N6OS |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 1-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]-3-[(2-propan-2-ylphenyl)carbamothioyl]urea |
| SMILES | Cc1ccc(-n2cnc(-c3ccc(NC(=O)NC(=S)Nc4ccccc4C(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C26H26N6OS/c1-17(2)22-6-4-5-7-23(22)29-26(34)30-25(33)28-20-12-10-19(11-13-20)24-27-16-32(31-24)21-14-8-18(3)9-15-21/h4-17H,1-3H3,(H3,28,29,30,33,34) |
| InChIKey | BBXVJVQBPSNKIP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|