C30H31F3N6O2S — CID 90404147
1-[(2-propan-2-ylphenyl)carbamothioyl]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea (PubChem CID 90404147) has the molecular formula C30H31F3N6O2S and a molecular weight of 596.68 g/mol. Its IUPAC name is 1-[(2-propan-2-ylphenyl)carbamothioyl]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea.
| Compound Name | 1-[(2-propan-2-ylphenyl)carbamothioyl]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea |
|---|---|
| PubChem CID | 90404147 |
| Molecular Formula | C30H31F3N6O2S |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 1-[(2-propan-2-ylphenyl)carbamothioyl]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea |
| SMILES | CC(C)c1ccccc1NC(=S)NC(=O)NCCCCc1cccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C30H31F3N6O2S/c1-20(2)25-11-3-4-12-26(25)36-29(42)37-28(40)34-17-6-5-8-21-9-7-10-22(18-21)27-35-19-39(38-27)23-13-15-24(16-14-23)41-30(31,32)33/h3-4,7,9-16,18-20H,5-6,8,17H2,1-2H3,(H3,34,36,37,40,42) |
| InChIKey | SNYBXZHUBMSFBP-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|