C29H30F3N5O2 — CID 118675044
1-(2-propan-2-ylphenyl)-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea (PubChem CID 118675044) has the molecular formula C29H30F3N5O2 and a molecular weight of 537.59 g/mol. Its IUPAC name is 1-(2-propan-2-ylphenyl)-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea.
| Compound Name | 1-(2-propan-2-ylphenyl)-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea |
|---|---|
| PubChem CID | 118675044 |
| Molecular Formula | C29H30F3N5O2 |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 1-(2-propan-2-ylphenyl)-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea |
| SMILES | CC(C)c1ccccc1NC(=O)NCCCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C29H30F3N5O2/c1-20(2)25-8-3-4-9-26(25)35-28(38)33-18-6-5-7-21-10-12-22(13-11-21)27-34-19-37(36-27)23-14-16-24(17-15-23)39-29(30,31)32/h3-4,8-17,19-20H,5-7,18H2,1-2H3,(H2,33,35,38) |
| InChIKey | UBLJVCYXYUZQJM-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|