C25H21ClF3N5O2 — CID 118675196
1-(2-chlorophenyl)-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea (PubChem CID 118675196) has the molecular formula C25H21ClF3N5O2 and a molecular weight of 515.92 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea |
|---|---|
| PubChem CID | 118675196 |
| Molecular Formula | C25H21ClF3N5O2 |
| Molecular Weight | 515.92 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea |
| SMILES | O=C(NCCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C25H21ClF3N5O2/c26-21-5-1-2-6-22(21)32-24(35)30-15-3-4-17-7-9-18(10-8-17)23-31-16-34(33-23)19-11-13-20(14-12-19)36-25(27,28)29/h1-2,5-14,16H,3-4,15H2,(H2,30,32,35) |
| InChIKey | GSCRZYXGVLOEOO-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.92 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|