C29H29F3N6O2S — CID 90404399
1-[(2-ethyl-6-methylphenyl)carbamothioyl]-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea (PubChem CID 90404399) has the molecular formula C29H29F3N6O2S and a molecular weight of 582.65 g/mol. Its IUPAC name is 1-[(2-ethyl-6-methylphenyl)carbamothioyl]-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea.
| Compound Name | 1-[(2-ethyl-6-methylphenyl)carbamothioyl]-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea |
|---|---|
| PubChem CID | 90404399 |
| Molecular Formula | C29H29F3N6O2S |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | 1-[(2-ethyl-6-methylphenyl)carbamothioyl]-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea |
| SMILES | CCc1cccc(C)c1NC(=S)NC(=O)NCCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C29H29F3N6O2S/c1-3-21-8-4-6-19(2)25(21)35-28(41)36-27(39)33-17-5-7-20-9-11-22(12-10-20)26-34-18-38(37-26)23-13-15-24(16-14-23)40-29(30,31)32/h4,6,8-16,18H,3,5,7,17H2,1-2H3,(H3,33,35,36,39,41) |
| InChIKey | QWWKYPIMBJJLBW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|