C32H28F3N5O2 — CID 175042096
1-(2-methyl-6-phenylphenyl)-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea (PubChem CID 175042096) has the molecular formula C32H28F3N5O2 and a molecular weight of 571.60 g/mol. Its IUPAC name is 1-(2-methyl-6-phenylphenyl)-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea.
| Compound Name | 1-(2-methyl-6-phenylphenyl)-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea |
|---|---|
| PubChem CID | 175042096 |
| Molecular Formula | C32H28F3N5O2 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | 1-(2-methyl-6-phenylphenyl)-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea |
| SMILES | Cc1cccc(-c2ccccc2)c1NC(=O)NCCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C32H28F3N5O2/c1-22-7-5-11-28(24-9-3-2-4-10-24)29(22)38-31(41)36-20-6-8-23-12-14-25(15-13-23)30-37-21-40(39-30)26-16-18-27(19-17-26)42-32(33,34)35/h2-5,7,9-19,21H,6,8,20H2,1H3,(H2,36,38,41) |
| InChIKey | ZIEXSLJMXVGFTM-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|