C31H35F3N6O2S — CID 152732884
1-[2-[(4-methyl-2-propan-2-ylphenyl)sulfanylamino]ethyl]-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea (PubChem CID 152732884) has the molecular formula C31H35F3N6O2S and a molecular weight of 612.72 g/mol. Its IUPAC name is 1-[2-[(4-methyl-2-propan-2-ylphenyl)sulfanylamino]ethyl]-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea.
| Compound Name | 1-[2-[(4-methyl-2-propan-2-ylphenyl)sulfanylamino]ethyl]-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea |
|---|---|
| PubChem CID | 152732884 |
| Molecular Formula | C31H35F3N6O2S |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | 1-[2-[(4-methyl-2-propan-2-ylphenyl)sulfanylamino]ethyl]-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea |
| SMILES | Cc1ccc(SNCCNC(=O)NCCCc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C31H35F3N6O2S/c1-21(2)27-19-22(3)6-15-28(27)43-38-18-17-36-30(41)35-16-4-5-23-7-9-24(10-8-23)29-37-20-40(39-29)25-11-13-26(14-12-25)42-31(32,33)34/h6-15,19-21,38H,4-5,16-18H2,1-3H3,(H2,35,36,41) |
| InChIKey | ZXZLIMCCPUWYMV-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|