C31H33F3N6O2S — CID 140709530
ethyl N-(5-methyl-2-propan-2-ylphenyl)-N-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylcarbamoyl]carbamimidothioate (PubChem CID 140709530) has the molecular formula C31H33F3N6O2S and a molecular weight of 610.71 g/mol. Its IUPAC name is ethyl N-(5-methyl-2-propan-2-ylphenyl)-N-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylcarbamoyl]carbamimidothioate.
| Compound Name | ethyl N-(5-methyl-2-propan-2-ylphenyl)-N-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylcarbamoyl]carbamimidothioate |
|---|---|
| PubChem CID | 140709530 |
| Molecular Formula | C31H33F3N6O2S |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | ethyl N-(5-methyl-2-propan-2-ylphenyl)-N-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylcarbamoyl]carbamimidothioate |
| SMILES | [H]/N=C(\SCC)N(C(=O)NCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)c1cc(C)ccc1C(C)C |
| InChI | InChI=1S/C31H33F3N6O2S/c1-5-43-29(35)40(27-18-21(4)6-15-26(27)20(2)3)30(41)36-17-16-22-7-9-23(10-8-22)28-37-19-39(38-28)24-11-13-25(14-12-24)42-31(32,33)34/h6-15,18-20,35H,5,16-17H2,1-4H3,(H,36,41)/b35-29- |
| InChIKey | DWBXMPKVXFEAAB-MJPNWULPSA-N |
| XLogP | 7.71 |
| TPSA | 96.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|