C33H34Cl3F3N6O2S — CID 134257252
methyl N-(5-methyl-2-propan-2-ylphenyl)-N-(3,3,3-trichloropropyl)-N'-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylcarbamoyl]carbamimidothioate (PubChem CID 134257252) has the molecular formula C33H34Cl3F3N6O2S and a molecular weight of 742.10 g/mol. Its IUPAC name is methyl N-(5-methyl-2-propan-2-ylphenyl)-N-(3,3,3-trichloropropyl)-N'-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylcarbamoyl]carbamimidothioate.
| Compound Name | methyl N-(5-methyl-2-propan-2-ylphenyl)-N-(3,3,3-trichloropropyl)-N'-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylcarbamoyl]carbamimidothioate |
|---|---|
| PubChem CID | 134257252 |
| Molecular Formula | C33H34Cl3F3N6O2S |
| Molecular Weight | 742.10 g/mol |
| Exact Mass | 740.15 |
| IUPAC Name | methyl N-(5-methyl-2-propan-2-ylphenyl)-N-(3,3,3-trichloropropyl)-N'-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylcarbamoyl]carbamimidothioate |
| SMILES | CS/C(=N\C(=O)NCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)N(CCC(Cl)(Cl)Cl)c1cc(C)ccc1C(C)C |
| InChI | InChI=1S/C33H34Cl3F3N6O2S/c1-21(2)27-14-5-22(3)19-28(27)44(18-16-32(34,35)36)31(48-4)42-30(46)40-17-15-23-6-8-24(9-7-23)29-41-20-45(43-29)25-10-12-26(13-11-25)47-33(37,38)39/h5-14,19-21H,15-18H2,1-4H3,(H,40,46)/b42-31- |
| InChIKey | UUPLEPBVAHHEGS-QZJDNAQXSA-N |
| XLogP | 9.50 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.10 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|