C33H35F3N6O3S — CID 144727688
ethyl N-formyl-N-(5-methyl-2-propan-2-ylphenyl)-N'-[3-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propylcarbamoyl]carbamimidothioate (PubChem CID 144727688) has the molecular formula C33H35F3N6O3S and a molecular weight of 652.74 g/mol. Its IUPAC name is ethyl N-formyl-N-(5-methyl-2-propan-2-ylphenyl)-N'-[3-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propylcarbamoyl]carbamimidothioate.
| Compound Name | ethyl N-formyl-N-(5-methyl-2-propan-2-ylphenyl)-N'-[3-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propylcarbamoyl]carbamimidothioate |
|---|---|
| PubChem CID | 144727688 |
| Molecular Formula | C33H35F3N6O3S |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.24 |
| IUPAC Name | ethyl N-formyl-N-(5-methyl-2-propan-2-ylphenyl)-N'-[3-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propylcarbamoyl]carbamimidothioate |
| SMILES | CCS/C(=N\C(=O)NCCCc1cccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)c1)N(C=O)c1cc(C)ccc1C(C)C |
| InChI | InChI=1S/C33H35F3N6O3S/c1-5-46-32(41(21-43)29-18-23(4)11-16-28(29)22(2)3)39-31(44)37-17-7-9-24-8-6-10-25(19-24)30-38-20-42(40-30)26-12-14-27(15-13-26)45-33(34,35)36/h6,8,10-16,18-22H,5,7,9,17H2,1-4H3,(H,37,44)/b39-32- |
| InChIKey | AZQZKLDOPLTONB-IJGATTDUSA-N |
| XLogP | 7.68 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|