C29H28ClF3N6O2S — CID 137247722
ethyl N'-(5-chloro-2-propan-2-ylphenyl)-N-[[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylcarbamoyl]carbamimidothioate (PubChem CID 137247722) has the molecular formula C29H28ClF3N6O2S and a molecular weight of 617.10 g/mol. Its IUPAC name is ethyl N'-(5-chloro-2-propan-2-ylphenyl)-N-[[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylcarbamoyl]carbamimidothioate.
| Compound Name | ethyl N'-(5-chloro-2-propan-2-ylphenyl)-N-[[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylcarbamoyl]carbamimidothioate |
|---|---|
| PubChem CID | 137247722 |
| Molecular Formula | C29H28ClF3N6O2S |
| Molecular Weight | 617.10 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | ethyl N'-(5-chloro-2-propan-2-ylphenyl)-N-[[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylcarbamoyl]carbamimidothioate |
| SMILES | CCS/C(=N\c1cc(Cl)ccc1C(C)C)NC(=O)NCc1cccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C29H28ClF3N6O2S/c1-4-42-28(36-25-15-21(30)8-13-24(25)18(2)3)37-27(40)34-16-19-6-5-7-20(14-19)26-35-17-39(38-26)22-9-11-23(12-10-22)41-29(31,32)33/h5-15,17-18H,4,16H2,1-3H3,(H2,34,36,37,40) |
| InChIKey | NGFYZYMUBUUVFQ-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.10 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|