C26H24F3N7O2 — CID 137103862
1-[N'-(2-propan-2-ylphenyl)carbamimidoyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 137103862) has the molecular formula C26H24F3N7O2 and a molecular weight of 523.52 g/mol. Its IUPAC name is 1-[N'-(2-propan-2-ylphenyl)carbamimidoyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | 1-[N'-(2-propan-2-ylphenyl)carbamimidoyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 137103862 |
| Molecular Formula | C26H24F3N7O2 |
| Molecular Weight | 523.52 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 1-[N'-(2-propan-2-ylphenyl)carbamimidoyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | CC(C)c1ccccc1/N=C(\N)NC(=O)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C26H24F3N7O2/c1-16(2)21-5-3-4-6-22(21)33-24(30)34-25(37)32-18-9-7-17(8-10-18)23-31-15-36(35-23)19-11-13-20(14-12-19)38-26(27,28)29/h3-16H,1-2H3,(H4,30,32,33,34,37) |
| InChIKey | UQJURPSSBHJDDD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|