C26H23F3N6O2S — CID 71488153
1-[(2-propan-2-ylphenyl)carbamothioyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 71488153) has the molecular formula C26H23F3N6O2S and a molecular weight of 540.57 g/mol. Its IUPAC name is 1-[(2-propan-2-ylphenyl)carbamothioyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | 1-[(2-propan-2-ylphenyl)carbamothioyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 71488153 |
| Molecular Formula | C26H23F3N6O2S |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 1-[(2-propan-2-ylphenyl)carbamothioyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | CC(C)c1ccccc1NC(=S)NC(=O)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C26H23F3N6O2S/c1-16(2)21-5-3-4-6-22(21)32-25(38)33-24(36)31-18-9-7-17(8-10-18)23-30-15-35(34-23)19-11-13-20(14-12-19)37-26(27,28)29/h3-16H,1-2H3,(H3,31,32,33,36,38) |
| InChIKey | RBJOQDCYCFBMBF-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|