C27H28N6OS — CID 89381980
1-[(2-tert-butylphenyl)carbamothioyl]-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 89381980) has the molecular formula C27H28N6OS and a molecular weight of 484.63 g/mol. Its IUPAC name is 1-[(2-tert-butylphenyl)carbamothioyl]-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | 1-[(2-tert-butylphenyl)carbamothioyl]-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 89381980 |
| Molecular Formula | C27H28N6OS |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 1-[(2-tert-butylphenyl)carbamothioyl]-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | Cc1ccc(-n2cnc(-c3ccc(NC(=O)NC(=S)Nc4ccccc4C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C27H28N6OS/c1-18-9-15-21(16-10-18)33-17-28-24(32-33)19-11-13-20(14-12-19)29-25(34)31-26(35)30-23-8-6-5-7-22(23)27(2,3)4/h5-17H,1-4H3,(H3,29,30,31,34,35) |
| InChIKey | GTGGOBYJFUECHY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|