C30H29F3N6O2S — CID 118898359
1-[(2-propan-2-ylphenyl)carbamothioyl]-3-[6-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]urea (PubChem CID 118898359) has the molecular formula C30H29F3N6O2S and a molecular weight of 594.66 g/mol. Its IUPAC name is 1-[(2-propan-2-ylphenyl)carbamothioyl]-3-[6-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]urea.
| Compound Name | 1-[(2-propan-2-ylphenyl)carbamothioyl]-3-[6-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]urea |
|---|---|
| PubChem CID | 118898359 |
| Molecular Formula | C30H29F3N6O2S |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | 1-[(2-propan-2-ylphenyl)carbamothioyl]-3-[6-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]urea |
| SMILES | CC(C)c1ccccc1NC(=S)NC(=O)NC1CCc2cc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)ccc2C1 |
| InChI | InChI=1S/C30H29F3N6O2S/c1-18(2)25-5-3-4-6-26(25)36-29(42)37-28(40)35-22-10-9-19-15-21(8-7-20(19)16-22)27-34-17-39(38-27)23-11-13-24(14-12-23)41-30(31,32)33/h3-8,11-15,17-18,22H,9-10,16H2,1-2H3,(H3,35,36,37,40,42) |
| InChIKey | GCLVWOXORLXYAQ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|