C31H29F5N6O2S — CID 118898392
1-[(5-methyl-2-propan-2-ylphenyl)carbamothioyl]-3-[5-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]-2,3-dihydro-1H-inden-2-yl]urea (PubChem CID 118898392) has the molecular formula C31H29F5N6O2S and a molecular weight of 644.67 g/mol. Its IUPAC name is 1-[(5-methyl-2-propan-2-ylphenyl)carbamothioyl]-3-[5-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]-2,3-dihydro-1H-inden-2-yl]urea.
| Compound Name | 1-[(5-methyl-2-propan-2-ylphenyl)carbamothioyl]-3-[5-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]-2,3-dihydro-1H-inden-2-yl]urea |
|---|---|
| PubChem CID | 118898392 |
| Molecular Formula | C31H29F5N6O2S |
| Molecular Weight | 644.67 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | 1-[(5-methyl-2-propan-2-ylphenyl)carbamothioyl]-3-[5-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]-2,3-dihydro-1H-inden-2-yl]urea |
| SMILES | Cc1ccc(C(C)C)c(NC(=S)NC(=O)NC2Cc3ccc(-c4ncn(-c5ccc(OC(F)(F)C(F)(F)F)cc5)n4)cc3C2)c1 |
| InChI | InChI=1S/C31H29F5N6O2S/c1-17(2)25-11-4-18(3)12-26(25)39-29(45)40-28(43)38-22-14-19-5-6-20(13-21(19)15-22)27-37-16-42(41-27)23-7-9-24(10-8-23)44-31(35,36)30(32,33)34/h4-13,16-17,22H,14-15H2,1-3H3,(H3,38,39,40,43,45) |
| InChIKey | HQNCFNZMUPYATH-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.67 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|