C33H31F5N6OS2 — CID 163925216
1-[3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazol-2-ylidene]-3-[2-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]thiourea (PubChem CID 163925216) has the molecular formula C33H31F5N6OS2 and a molecular weight of 686.78 g/mol. Its IUPAC name is 1-[3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazol-2-ylidene]-3-[2-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]thiourea.
| Compound Name | 1-[3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazol-2-ylidene]-3-[2-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]thiourea |
|---|---|
| PubChem CID | 163925216 |
| Molecular Formula | C33H31F5N6OS2 |
| Molecular Weight | 686.78 g/mol |
| Exact Mass | 686.19 |
| IUPAC Name | 1-[3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazol-2-ylidene]-3-[2-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]thiourea |
| SMILES | Cc1ccc(C(C)C)c(-n2ccsc2=NC(=S)NCC(C)c2ccc(-c3ncn(-c4ccc(OC(F)(F)C(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C33H31F5N6OS2/c1-20(2)27-14-5-21(3)17-28(27)43-15-16-47-31(43)41-30(46)39-18-22(4)23-6-8-24(9-7-23)29-40-19-44(42-29)25-10-12-26(13-11-25)45-33(37,38)32(34,35)36/h5-17,19-20,22H,18H2,1-4H3,(H,39,46) |
| InChIKey | RDWMOPIPPWWQJB-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.78 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|