C30H27F3N6OS2 — CID 154039641
1-[4-methyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-ylidene]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]thiourea (PubChem CID 154039641) has the molecular formula C30H27F3N6OS2 and a molecular weight of 608.72 g/mol. Its IUPAC name is 1-[4-methyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-ylidene]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]thiourea.
| Compound Name | 1-[4-methyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-ylidene]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 154039641 |
| Molecular Formula | C30H27F3N6OS2 |
| Molecular Weight | 608.72 g/mol |
| Exact Mass | 608.16 |
| IUPAC Name | 1-[4-methyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-ylidene]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]thiourea |
| SMILES | Cc1csc(=NC(=S)NCc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)n1-c1ccccc1C(C)C |
| InChI | InChI=1S/C30H27F3N6OS2/c1-19(2)25-6-4-5-7-26(25)39-20(3)17-42-29(39)36-28(41)34-16-21-8-10-22(11-9-21)27-35-18-38(37-27)23-12-14-24(15-13-23)40-30(31,32)33/h4-15,17-19H,16H2,1-3H3,(H,34,41) |
| InChIKey | BBOHDDNJAVMVQK-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.72 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|