C33H35F3N6OS2 — CID 134486923
(1Z)-1-[3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazinan-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]thiourea (PubChem CID 134486923) has the molecular formula C33H35F3N6OS2 and a molecular weight of 652.81 g/mol. Its IUPAC name is (1Z)-1-[3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazinan-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]thiourea.
| Compound Name | (1Z)-1-[3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazinan-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]thiourea |
|---|---|
| PubChem CID | 134486923 |
| Molecular Formula | C33H35F3N6OS2 |
| Molecular Weight | 652.81 g/mol |
| Exact Mass | 652.23 |
| IUPAC Name | (1Z)-1-[3-(5-methyl-2-propan-2-ylphenyl)-1,3-thiazinan-2-ylidene]-3-[2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]thiourea |
| SMILES | Cc1ccc(C(C)C)c(N2CCCS/C2=N\C(=S)NCC(C)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C33H35F3N6OS2/c1-21(2)28-15-6-22(3)18-29(28)41-16-5-17-45-32(41)39-31(44)37-19-23(4)24-7-9-25(10-8-24)30-38-20-42(40-30)26-11-13-27(14-12-26)43-33(34,35)36/h6-15,18,20-21,23H,5,16-17,19H2,1-4H3,(H,37,44)/b39-32- |
| InChIKey | UVWFRHHFVNQKNI-IJGATTDUSA-N |
| XLogP | 8.24 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.81 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|