C32H28ClF3N6O3S — CID 118898356
(1Z)-1-[3-(5-chloro-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[6-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]urea (PubChem CID 118898356) has the molecular formula C32H28ClF3N6O3S and a molecular weight of 669.13 g/mol. Its IUPAC name is (1Z)-1-[3-(5-chloro-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[6-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]urea.
| Compound Name | (1Z)-1-[3-(5-chloro-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[6-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]urea |
|---|---|
| PubChem CID | 118898356 |
| Molecular Formula | C32H28ClF3N6O3S |
| Molecular Weight | 669.13 g/mol |
| Exact Mass | 668.16 |
| IUPAC Name | (1Z)-1-[3-(5-chloro-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[6-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]urea |
| SMILES | CC(C)c1ccc(Cl)cc1N1C(=O)CS/C1=N\C(=O)NC1CCc2cc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)ccc2C1 |
| InChI | InChI=1S/C32H28ClF3N6O3S/c1-18(2)26-12-6-22(33)15-27(26)42-28(43)16-46-31(42)39-30(44)38-23-7-5-19-13-21(4-3-20(19)14-23)29-37-17-41(40-29)24-8-10-25(11-9-24)45-32(34,35)36/h3-4,6,8-13,15,17-18,23H,5,7,14,16H2,1-2H3,(H,38,44)/b39-31- |
| InChIKey | KPBRJDQXADXRNQ-RZLPTWENSA-N |
| XLogP | 7.31 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.13 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|