C29H24ClF3N6O3S2 — CID 163653292
1-[3-(5-chloro-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methoxy]thiourea (PubChem CID 163653292) has the molecular formula C29H24ClF3N6O3S2 and a molecular weight of 661.13 g/mol. Its IUPAC name is 1-[3-(5-chloro-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methoxy]thiourea.
| Compound Name | 1-[3-(5-chloro-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methoxy]thiourea |
|---|---|
| PubChem CID | 163653292 |
| Molecular Formula | C29H24ClF3N6O3S2 |
| Molecular Weight | 661.13 g/mol |
| Exact Mass | 660.10 |
| IUPAC Name | 1-[3-(5-chloro-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methoxy]thiourea |
| SMILES | CC(C)c1ccc(Cl)cc1N1C(=O)CSC1=NC(=S)NOCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C29H24ClF3N6O3S2/c1-17(2)23-12-7-20(30)13-24(23)39-25(40)15-44-28(39)35-27(43)37-41-14-18-3-5-19(6-4-18)26-34-16-38(36-26)21-8-10-22(11-9-21)42-29(31,32)33/h3-13,16-17H,14-15H2,1-2H3,(H,37,43) |
| InChIKey | IOBAUSDXRRGODH-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.13 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|