C28H23F5N6O4S — CID 136629960
[N'-(2,6-difluorophenyl)-N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl 2-methylpropanoate (PubChem CID 136629960) has the molecular formula C28H23F5N6O4S and a molecular weight of 634.59 g/mol. Its IUPAC name is [N'-(2,6-difluorophenyl)-N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl 2-methylpropanoate.
| Compound Name | [N'-(2,6-difluorophenyl)-N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 136629960 |
| Molecular Formula | C28H23F5N6O4S |
| Molecular Weight | 634.59 g/mol |
| Exact Mass | 634.14 |
| IUPAC Name | [N'-(2,6-difluorophenyl)-N-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCS/C(=N\c1c(F)cccc1F)NC(=O)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C28H23F5N6O4S/c1-16(2)25(40)42-15-44-27(36-23-21(29)4-3-5-22(23)30)37-26(41)35-18-8-6-17(7-9-18)24-34-14-39(38-24)19-10-12-20(13-11-19)43-28(31,32)33/h3-14,16H,15H2,1-2H3,(H2,35,36,37,41) |
| InChIKey | YPSGMXAMADUPGM-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.59 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|