C31H30F3N7O5S — CID 136629966
[N'-(2,6-dimethylphenyl)-N-[[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl 2-(ethoxycarbonylamino)acetate (PubChem CID 136629966) has the molecular formula C31H30F3N7O5S and a molecular weight of 669.69 g/mol. Its IUPAC name is [N'-(2,6-dimethylphenyl)-N-[[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl 2-(ethoxycarbonylamino)acetate.
| Compound Name | [N'-(2,6-dimethylphenyl)-N-[[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl 2-(ethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 136629966 |
| Molecular Formula | C31H30F3N7O5S |
| Molecular Weight | 669.69 g/mol |
| Exact Mass | 669.20 |
| IUPAC Name | [N'-(2,6-dimethylphenyl)-N-[[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl 2-(ethoxycarbonylamino)acetate |
| SMILES | CCOC(=O)NCC(=O)OCS/C(=N\c1c(C)cccc1C)NC(=O)Nc1ccc(-c2ncn(-c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C31H30F3N7O5S/c1-4-45-30(44)35-16-25(42)46-18-47-29(38-26-19(2)6-5-7-20(26)3)39-28(43)37-23-12-8-21(9-13-23)27-36-17-41(40-27)24-14-10-22(11-15-24)31(32,33)34/h5-15,17H,4,16,18H2,1-3H3,(H,35,44)(H2,37,38,39,43) |
| InChIKey | HZJAIHFCPJVPAL-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 148.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.69 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|