C32H28F3N7O3S2 — CID 88853715
(4-sulfamoylphenyl)methyl N'-(2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidothioate (PubChem CID 88853715) has the molecular formula C32H28F3N7O3S2 and a molecular weight of 679.75 g/mol. Its IUPAC name is (4-sulfamoylphenyl)methyl N'-(2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | (4-sulfamoylphenyl)methyl N'-(2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 88853715 |
| Molecular Formula | C32H28F3N7O3S2 |
| Molecular Weight | 679.75 g/mol |
| Exact Mass | 679.16 |
| IUPAC Name | (4-sulfamoylphenyl)methyl N'-(2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidothioate |
| SMILES | Cc1cccc(C)c1/N=C(/N/N=C/c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)SCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C32H28F3N7O3S2/c1-21-4-3-5-22(2)29(21)39-31(46-19-24-8-16-28(17-9-24)47(36,43)44)40-38-18-23-6-10-25(11-7-23)30-37-20-42(41-30)26-12-14-27(15-13-26)45-32(33,34)35/h3-18,20H,19H2,1-2H3,(H,39,40)(H2,36,43,44)/b38-18+ |
| InChIKey | OZGHCQBWJHCXBE-CDLBOOTPSA-N |
| XLogP | 6.64 |
| TPSA | 136.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.75 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|