C32H25F5N6OS — CID 88853709
(2,4-difluorophenyl)methyl N'-(2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidothioate (PubChem CID 88853709) has the molecular formula C32H25F5N6OS and a molecular weight of 636.65 g/mol. Its IUPAC name is (2,4-difluorophenyl)methyl N'-(2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | (2,4-difluorophenyl)methyl N'-(2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 88853709 |
| Molecular Formula | C32H25F5N6OS |
| Molecular Weight | 636.65 g/mol |
| Exact Mass | 636.17 |
| IUPAC Name | (2,4-difluorophenyl)methyl N'-(2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidothioate |
| SMILES | Cc1cccc(C)c1/N=C(/N/N=C/c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)SCc1ccc(F)cc1F |
| InChI | InChI=1S/C32H25F5N6OS/c1-20-4-3-5-21(2)29(20)40-31(45-18-24-10-11-25(33)16-28(24)34)41-39-17-22-6-8-23(9-7-22)30-38-19-43(42-30)26-12-14-27(15-13-26)44-32(35,36)37/h3-17,19H,18H2,1-2H3,(H,40,41)/b39-17+ |
| InChIKey | OQQRZDUSJIBFQN-HZTVMEOHSA-N |
| XLogP | 8.27 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.65 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|