C29H25F5N6O4S — CID 88853752
2-[N'-(4-methoxy-2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidoyl]sulfanylacetic acid (PubChem CID 88853752) has the molecular formula C29H25F5N6O4S and a molecular weight of 648.61 g/mol. Its IUPAC name is 2-[N'-(4-methoxy-2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidoyl]sulfanylacetic acid.
| Compound Name | 2-[N'-(4-methoxy-2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidoyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 88853752 |
| Molecular Formula | C29H25F5N6O4S |
| Molecular Weight | 648.61 g/mol |
| Exact Mass | 648.16 |
| IUPAC Name | 2-[N'-(4-methoxy-2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidoyl]sulfanylacetic acid |
| SMILES | COc1cc(C)c(/N=C(/N/N=C/c2ccc(-c3ncn(-c4ccc(OC(F)(F)C(F)(F)F)cc4)n3)cc2)SCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C29H25F5N6O4S/c1-17-12-23(43-3)13-18(2)25(17)37-27(45-15-24(41)42)38-36-14-19-4-6-20(7-5-19)26-35-16-40(39-26)21-8-10-22(11-9-21)44-29(33,34)28(30,31)32/h4-14,16H,15H2,1-3H3,(H,37,38)(H,41,42)/b36-14+ |
| InChIKey | SMNQQJKXZBJWMR-QQMJPZKZSA-N |
| XLogP | 6.52 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|