C31H33F3N8O3S — CID 88853763
[2-(3-aminopropylamino)-2-oxoethyl] N'-(4-methoxy-2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidothioate (PubChem CID 88853763) has the molecular formula C31H33F3N8O3S and a molecular weight of 654.72 g/mol. Its IUPAC name is [2-(3-aminopropylamino)-2-oxoethyl] N'-(4-methoxy-2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | [2-(3-aminopropylamino)-2-oxoethyl] N'-(4-methoxy-2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 88853763 |
| Molecular Formula | C31H33F3N8O3S |
| Molecular Weight | 654.72 g/mol |
| Exact Mass | 654.23 |
| IUPAC Name | [2-(3-aminopropylamino)-2-oxoethyl] N'-(4-methoxy-2,6-dimethylphenyl)-N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidothioate |
| SMILES | COc1cc(C)c(/N=C(/N/N=C/c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)SCC(=O)NCCCN)c(C)c1 |
| InChI | InChI=1S/C31H33F3N8O3S/c1-20-15-26(44-3)16-21(2)28(20)39-30(46-18-27(43)36-14-4-13-35)40-38-17-22-5-7-23(8-6-22)29-37-19-42(41-29)24-9-11-25(12-10-24)45-31(32,33)34/h5-12,15-17,19H,4,13-14,18,35H2,1-3H3,(H,36,43)(H,39,40)/b38-17+ |
| InChIKey | JCZGQQGEGDLVLP-OAQMXIGCSA-N |
| XLogP | 5.27 |
| TPSA | 141.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.72 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|