C28H23F5N6O3S — CID 123394152
2-[N'-(2,6-dimethylphenyl)-N-[(Z)-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidoyl]sulfanylacetic acid (PubChem CID 123394152) has the molecular formula C28H23F5N6O3S and a molecular weight of 618.59 g/mol. Its IUPAC name is 2-[N'-(2,6-dimethylphenyl)-N-[(Z)-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidoyl]sulfanylacetic acid.
| Compound Name | 2-[N'-(2,6-dimethylphenyl)-N-[(Z)-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidoyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 123394152 |
| Molecular Formula | C28H23F5N6O3S |
| Molecular Weight | 618.59 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | 2-[N'-(2,6-dimethylphenyl)-N-[(Z)-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamimidoyl]sulfanylacetic acid |
| SMILES | Cc1cccc(C)c1/N=C(/N/N=C\c1ccc(-c2ncn(-c3ccc(OC(F)(F)C(F)(F)F)cc3)n2)cc1)SCC(=O)O |
| InChI | InChI=1S/C28H23F5N6O3S/c1-17-4-3-5-18(2)24(17)36-26(43-15-23(40)41)37-35-14-19-6-8-20(9-7-19)25-34-16-39(38-25)21-10-12-22(13-11-21)42-28(32,33)27(29,30)31/h3-14,16H,15H2,1-2H3,(H,36,37)(H,40,41)/b35-14- |
| InChIKey | NAYPKFSJXFZPIU-BQIMNVTISA-N |
| XLogP | 6.51 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.59 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|