C27H25F3N6O3S — CID 138511597
[N'-(2,6-dimethylphenyl)-N-[[4-[N'-[[4-(trifluoromethyl)phenyl]iminomethyl]carbamimidoyl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl formate (PubChem CID 138511597) has the molecular formula C27H25F3N6O3S and a molecular weight of 570.60 g/mol. Its IUPAC name is [N'-(2,6-dimethylphenyl)-N-[[4-[N'-[[4-(trifluoromethyl)phenyl]iminomethyl]carbamimidoyl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl formate.
| Compound Name | [N'-(2,6-dimethylphenyl)-N-[[4-[N'-[[4-(trifluoromethyl)phenyl]iminomethyl]carbamimidoyl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl formate |
|---|---|
| PubChem CID | 138511597 |
| Molecular Formula | C27H25F3N6O3S |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | [N'-(2,6-dimethylphenyl)-N-[[4-[N'-[[4-(trifluoromethyl)phenyl]iminomethyl]carbamimidoyl]phenyl]carbamoyl]carbamimidoyl]sulfanylmethyl formate |
| SMILES | Cc1cccc(C)c1/N=C(/NC(=O)Nc1ccc(/C(N)=N/C=N/c2ccc(C(F)(F)F)cc2)cc1)SCOC=O |
| InChI | InChI=1S/C27H25F3N6O3S/c1-17-4-3-5-18(2)23(17)35-26(40-16-39-15-37)36-25(38)34-22-10-6-19(7-11-22)24(31)33-14-32-21-12-8-20(9-13-21)27(28,29)30/h3-15H,16H2,1-2H3,(H2,31,32,33)(H2,34,35,36,38) |
| InChIKey | RHNGMUCKRDXWRB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 130.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|