C18H16F3N5O2S — CID 138511594
(Z)-3-amino-3-sulfanyl-N-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]prop-2-enamide (PubChem CID 138511594) has the molecular formula C18H16F3N5O2S and a molecular weight of 423.42 g/mol. Its IUPAC name is (Z)-3-amino-3-sulfanyl-N-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]prop-2-enamide.
| Compound Name | (Z)-3-amino-3-sulfanyl-N-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 138511594 |
| Molecular Formula | C18H16F3N5O2S |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | (Z)-3-amino-3-sulfanyl-N-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]prop-2-enamide |
| SMILES | N/C(S)=C/C(=O)Nc1ccc(/C(N)=N/C=N/c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H16F3N5O2S/c19-18(20,21)28-14-7-5-12(6-8-14)24-10-25-17(23)11-1-3-13(4-2-11)26-16(27)9-15(22)29/h1-10,29H,22H2,(H,26,27)(H2,23,24,25)/b15-9- |
| InChIKey | DGENZGFMDHCOPL-DHDCSXOGSA-N |
| XLogP | 3.32 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|