C18H16F3N3O3 — CID 144727689
methyl 2-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]acetate (PubChem CID 144727689) has the molecular formula C18H16F3N3O3 and a molecular weight of 379.34 g/mol. Its IUPAC name is methyl 2-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]acetate.
| Compound Name | methyl 2-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]acetate |
|---|---|
| PubChem CID | 144727689 |
| Molecular Formula | C18H16F3N3O3 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | methyl 2-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(/C(N)=N/C=N/c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H16F3N3O3/c1-26-16(25)10-12-2-4-13(5-3-12)17(22)24-11-23-14-6-8-15(9-7-14)27-18(19,20)21/h2-9,11H,10H2,1H3,(H2,22,23,24) |
| InChIKey | RMOZYCOMKCSPST-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|