C27H20F6N6O2S — CID 123214851
4-[(Z)-[(E)-[4-methyl-3-[2-(trifluoromethoxy)phenyl]-1,3-thiazol-2-ylidene]hydrazinylidene]methyl]-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide (PubChem CID 123214851) has the molecular formula C27H20F6N6O2S and a molecular weight of 606.55 g/mol. Its IUPAC name is 4-[(Z)-[(E)-[4-methyl-3-[2-(trifluoromethoxy)phenyl]-1,3-thiazol-2-ylidene]hydrazinylidene]methyl]-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide.
| Compound Name | 4-[(Z)-[(E)-[4-methyl-3-[2-(trifluoromethoxy)phenyl]-1,3-thiazol-2-ylidene]hydrazinylidene]methyl]-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 123214851 |
| Molecular Formula | C27H20F6N6O2S |
| Molecular Weight | 606.55 g/mol |
| Exact Mass | 606.13 |
| IUPAC Name | 4-[(Z)-[(E)-[4-methyl-3-[2-(trifluoromethoxy)phenyl]-1,3-thiazol-2-ylidene]hydrazinylidene]methyl]-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide |
| SMILES | Cc1cs/c(=N/N=C\c2ccc(/C(N)=N/C=N/c3ccc(OC(F)(F)F)cc3)cc2)n1-c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C27H20F6N6O2S/c1-17-15-42-25(39(17)22-4-2-3-5-23(22)41-27(31,32)33)38-37-14-18-6-8-19(9-7-18)24(34)36-16-35-20-10-12-21(13-11-20)40-26(28,29)30/h2-16H,1H3,(H2,34,35,36)/b37-14-,38-25+ |
| InChIKey | VADCVKVYRIIKPP-GKHBGCLKSA-N |
| XLogP | 6.64 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.55 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|