C26H21Cl2F3N6OS — CID 123745074
4-[(Z)-[(E)-[3-(2,6-dichlorophenyl)-4-methyl-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide (PubChem CID 123745074) has the molecular formula C26H21Cl2F3N6OS and a molecular weight of 593.46 g/mol. Its IUPAC name is 4-[(Z)-[(E)-[3-(2,6-dichlorophenyl)-4-methyl-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide.
| Compound Name | 4-[(Z)-[(E)-[3-(2,6-dichlorophenyl)-4-methyl-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 123745074 |
| Molecular Formula | C26H21Cl2F3N6OS |
| Molecular Weight | 593.46 g/mol |
| Exact Mass | 592.08 |
| IUPAC Name | 4-[(Z)-[(E)-[3-(2,6-dichlorophenyl)-4-methyl-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide |
| SMILES | CC1CS/C(=N/N=C\c2ccc(/C(N)=N/C=N/c3ccc(OC(F)(F)F)cc3)cc2)N1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H21Cl2F3N6OS/c1-16-14-39-25(37(16)23-21(27)3-2-4-22(23)28)36-35-13-17-5-7-18(8-6-17)24(32)34-15-33-19-9-11-20(12-10-19)38-26(29,30)31/h2-13,15-16H,14H2,1H3,(H2,32,33,34)/b35-13-,36-25+ |
| InChIKey | ROOMFVFIIWCLDH-RVFWCPFGSA-N |
| XLogP | 7.29 |
| TPSA | 87.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.46 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|