C23H25F3N6OS — CID 90180776
1-cyclohexyl-3-[(E)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]thiourea (PubChem CID 90180776) has the molecular formula C23H25F3N6OS and a molecular weight of 490.56 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(E)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-cyclohexyl-3-[(E)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 90180776 |
| Molecular Formula | C23H25F3N6OS |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 1-cyclohexyl-3-[(E)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]thiourea |
| SMILES | N/C(=N\C=N\c1ccc(OC(F)(F)F)cc1)c1ccc(/C=N/NC(=S)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C23H25F3N6OS/c24-23(25,26)33-20-12-10-18(11-13-20)28-15-29-21(27)17-8-6-16(7-9-17)14-30-32-22(34)31-19-4-2-1-3-5-19/h6-15,19H,1-5H2,(H2,27,28,29)(H2,31,32,34)/b30-14+ |
| InChIKey | MHSPXIAIJHVYED-AMVVHIIESA-N |
| XLogP | 4.78 |
| TPSA | 96.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|