C22H18F3N7OS — CID 123697297
1-pyridin-2-yl-3-[(Z)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]thiourea (PubChem CID 123697297) has the molecular formula C22H18F3N7OS and a molecular weight of 485.50 g/mol. Its IUPAC name is 1-pyridin-2-yl-3-[(Z)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-pyridin-2-yl-3-[(Z)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 123697297 |
| Molecular Formula | C22H18F3N7OS |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 1-pyridin-2-yl-3-[(Z)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]thiourea |
| SMILES | N/C(=N\C=N\c1ccc(OC(F)(F)F)cc1)c1ccc(/C=N\NC(=S)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C22H18F3N7OS/c23-22(24,25)33-18-10-8-17(9-11-18)28-14-29-20(26)16-6-4-15(5-7-16)13-30-32-21(34)31-19-3-1-2-12-27-19/h1-14H,(H2,26,28,29)(H2,27,31,32,34)/b30-13- |
| InChIKey | DQORNZGVQYQGSO-YNFMAFFXSA-N |
| XLogP | 4.37 |
| TPSA | 109.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|