C26H26F3N5O2S — CID 161392847
N-(2-ethoxyphenyl)ethanethioamide;4-methanimidoyl-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide (PubChem CID 161392847) has the molecular formula C26H26F3N5O2S and a molecular weight of 529.59 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)ethanethioamide;4-methanimidoyl-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide.
| Compound Name | N-(2-ethoxyphenyl)ethanethioamide;4-methanimidoyl-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 161392847 |
| Molecular Formula | C26H26F3N5O2S |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | N-(2-ethoxyphenyl)ethanethioamide;4-methanimidoyl-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide |
| SMILES | CCOc1ccccc1NC(C)=S.[H]/N=C/c1ccc(/C(N)=N/C=N/c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H13F3N4O.C10H13NOS/c17-16(18,19)24-14-7-5-13(6-8-14)22-10-23-15(21)12-3-1-11(9-20)2-4-12;1-3-12-10-7-5-4-6-9(10)11-8(2)13/h1-10,20H,(H2,21,22,23);4-7H,3H2,1-2H3,(H,11,13)/b20-9+; |
| InChIKey | VTFHGBWNHZOXFZ-NFLPFLSFSA-N |
| XLogP | 6.49 |
| TPSA | 105.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|