C29H27F3N6OS — CID 123306970
4-[(Z)-[(E)-[3-(2-cyclopropylphenyl)-1,3-thiazinan-2-ylidene]hydrazinylidene]methyl]-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide (PubChem CID 123306970) has the molecular formula C29H27F3N6OS and a molecular weight of 564.64 g/mol. Its IUPAC name is 4-[(Z)-[(E)-[3-(2-cyclopropylphenyl)-1,3-thiazinan-2-ylidene]hydrazinylidene]methyl]-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide.
| Compound Name | 4-[(Z)-[(E)-[3-(2-cyclopropylphenyl)-1,3-thiazinan-2-ylidene]hydrazinylidene]methyl]-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 123306970 |
| Molecular Formula | C29H27F3N6OS |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 4-[(Z)-[(E)-[3-(2-cyclopropylphenyl)-1,3-thiazinan-2-ylidene]hydrazinylidene]methyl]-N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]benzenecarboximidamide |
| SMILES | N/C(=N\C=N\c1ccc(OC(F)(F)F)cc1)c1ccc(/C=N\N=C2\SCCCN2c2ccccc2C2CC2)cc1 |
| InChI | InChI=1S/C29H27F3N6OS/c30-29(31,32)39-24-14-12-23(13-15-24)34-19-35-27(33)22-8-6-20(7-9-22)18-36-37-28-38(16-3-17-40-28)26-5-2-1-4-25(26)21-10-11-21/h1-2,4-9,12-15,18-19,21H,3,10-11,16-17H2,(H2,33,34,35)/b36-18-,37-28+ |
| InChIKey | AGRBDRLNZZTBBX-MBXMSAEFSA-N |
| XLogP | 6.86 |
| TPSA | 87.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|